Current predictor: Aerobic biodegradation
Last update: June 26, 2022
Dataset used for model development
Download the complete dataset
Summary:
Total entries: 12750
Ready entries: 11477
Inherent entries: 1273
Index | Substance name | CAS number | SMILES | Time (day) | Guideline | Principle | Endpoint | Reliability | Value |
---|---|---|---|---|---|---|---|---|---|
1 | Bubet | 407-64-7 | C[N+](C)(C)CCCC(=O)[O-] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.98 |
2 | (3-aminopropyl)({[(3-aminopropyl)dimethylsilyl]oxy})dimethylsilane | 2469-55-8 | C[Si](C)(CCCN)O[Si](C)(C)CCCN | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.67 |
3 | 3-(dimethoxymethylsilyl)propyl methacrylate | 14513-34-9 | C=C(C)C(=O)OCCC[Si](C)(OC)OC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
4 | 3-(trimethoxysilyl)propyl 2-methylprop-2-enoate | 2530-85-0 | C=C(C)C(=O)OCCC[Si](OC)(OC)OC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
5 | 3-(triethoxysilyl)propyl 2-methylprop-2-enoate | 21142-29-0 | C=C(C)C(=O)OCCC[Si](OCC)(OCC)OCC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
6 | 2-(tert-butylamino)ethyl 2-methylprop-2-enoate | 3775-90-4 | C=C(C)C(=O)OCCNC(C)(C)C | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.37 |
7 | 2-(tert-butylamino)ethyl 2-methylprop-2-enoate | 3775-90-4 | C=C(C)C(=O)OCCNC(C)(C)C | 24.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.48 |
8 | sodium 2-methylprop-2-ene-1-sulfonate | 1561-92-8 | C=C(C)CS(=O)(=O)[O-].[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.03 |
9 | bis(acetyloxy)(ethenyl)silyl acetate | 4130-08-9 | C=C[Si](OC(C)=O)(OC(C)=O)OC(C)=O | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
10 | tri(isopropoxy)vinylsilane | 18023-33-1 | C=C[Si](OC(C)C)(OC(C)C)OC(C)C | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.89 |
11 | Tris(2-methoxyethoxy)vinylsilane | 1067-53-4 | C=C[Si](OCCOC)(OCCOC)OCCOC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.89 |
12 | sodium prop-2-enoate | 7446-81-3 | C=CC(=O)[O-].[Na+] | 9.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.95 |
13 | zinc(2+) ion bis(prop-2-enoate) | 14643-87-9 | C=CC(=O)[O-].C=CC(=O)[O-].[Zn+2] | 9.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.95 |
14 | prop-2-enoic acid | 79-10-7 | C=CC(=O)O | 9.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.95 |
15 | tert-butyl prop-2-enoate | 1663-39-4 | C=CC(=O)OC(C)(C)C | 9.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.95 |
16 | 2-phenyl-4,5-dihydro-1H-imidazole | 936-49-2 | c1ccc(C2=[NH+]CCN2)cc1 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.68 |
17 | 1,3,5,7-tetraazatricyclo[3.3.1.1³,⁷]decane | 100-97-0 | C1N2CN3CN1CN(C2)C3 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.39 |
18 | 1,2,4-triazole | 288-88-0 | c1nc[nH]n1 | 24.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.16 |
19 | potassium acetate | 127-08-2 | CC(=O)[O-].[K+] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.86 |
20 | potassium acetate | 127-08-2 | CC(=O)[O-].[K+] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.91 |
21 | potassium acetate | 127-08-2 | CC(=O)[O-].[K+] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.93 |
22 | potassium acetate | 127-08-2 | CC(=O)[O-].[K+] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
23 | potassium acetate | 127-08-2 | CC(=O)[O-].[K+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
24 | sodium acetate | 127-09-3 | CC(=O)[O-].[Na+] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.86 |
25 | sodium acetate | 127-09-3 | CC(=O)[O-].[Na+] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.91 |
26 | sodium acetate | 127-09-3 | CC(=O)[O-].[Na+] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.93 |
27 | sodium acetate | 127-09-3 | CC(=O)[O-].[Na+] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
28 | sodium acetate | 127-09-3 | CC(=O)[O-].[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
29 | ammonium acetate | 631-61-8 | CC(=O)[O-].[NH4+] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.86 |
30 | ammonium acetate | 631-61-8 | CC(=O)[O-].[NH4+] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.91 |
31 | ammonium acetate | 631-61-8 | CC(=O)[O-].[NH4+] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.93 |
32 | ammonium acetate | 631-61-8 | CC(=O)[O-].[NH4+] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
33 | ammonium acetate | 631-61-8 | CC(=O)[O-].[NH4+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
34 | calcium diacetate | 62-54-4 | CC(=O)[O-].CC(=O)[O-].[Ca+2] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.86 |
35 | calcium diacetate | 62-54-4 | CC(=O)[O-].CC(=O)[O-].[Ca+2] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.91 |
36 | calcium diacetate | 62-54-4 | CC(=O)[O-].CC(=O)[O-].[Ca+2] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.93 |
37 | calcium diacetate | 62-54-4 | CC(=O)[O-].CC(=O)[O-].[Ca+2] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
38 | calcium diacetate | 62-54-4 | CC(=O)[O-].CC(=O)[O-].[Ca+2] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
39 | magnesium(2+) diacetate | 142-72-3 | CC(=O)[O-].CC(=O)[O-].[Mg+2] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.86 |
40 | magnesium(2+) diacetate | 142-72-3 | CC(=O)[O-].CC(=O)[O-].[Mg+2] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.91 |
41 | magnesium(2+) diacetate | 142-72-3 | CC(=O)[O-].CC(=O)[O-].[Mg+2] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.93 |
42 | magnesium(2+) diacetate | 142-72-3 | CC(=O)[O-].CC(=O)[O-].[Mg+2] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
43 | magnesium(2+) ion diacetate | 142-72-3 | CC(=O)[O-].CC(=O)[O-].[Mg+2] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
44 | zinc(2+) diacetate | 557-34-6 | CC(=O)[O-].CC(=O)[O-].[Zn+2] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.86 |
45 | zinc(2+) diacetate | 557-34-6 | CC(=O)[O-].CC(=O)[O-].[Zn+2] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.91 |
46 | zinc(2+) diacetate | 557-34-6 | CC(=O)[O-].CC(=O)[O-].[Zn+2] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.93 |
47 | zinc(2+) diacetate | 557-34-6 | CC(=O)[O-].CC(=O)[O-].[Zn+2] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
48 | zinc(2+) ion diacetate | 557-34-6 | CC(=O)[O-].CC(=O)[O-].[Zn+2] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
49 | sodium hydrogen diacetate | 126-96-5 | CC(=O)O.CC(=O)[O-].[Na+] | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.86 |
50 | sodium hydrogen diacetate | 126-96-5 | CC(=O)O.CC(=O)[O-].[Na+] | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.91 |
51 | sodium hydrogen diacetate | 126-96-5 | CC(=O)O.CC(=O)[O-].[Na+] | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.93 |
52 | sodium hydrogen diacetate | 126-96-5 | CC(=O)O.CC(=O)[O-].[Na+] | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.99 |
53 | sodium hydrogen diacetate | 126-96-5 | CC(=O)O.CC(=O)[O-].[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.99 |
54 | bis(acetyloxy)(methyl)silyl acetate | 4253-34-3 | CC(=O)O[Si](C)(OC(C)=O)OC(C)=O | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
55 | 4-tert-butylphenol | 98-54-4 | CC(C)(C)c1ccc(O)cc1 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.98 |
56 | 2-tert-butylphenol | 88-18-6 | CC(C)(C)c1ccccc1O | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.98 |
57 | 2-methylpropan-2-ol | 75-65-0 | CC(C)(C)O | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.99 |
58 | 2,2,4-trimethylhexanedioic acid; 2,4,4-trimethylhexanedioic acid | 53445-37-7 | CC(CC(=O)O)CC(C)(C)C(=O)O | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.25 |
59 | 2,2,4-trimethylhexanedioic acid; 2,4,4-trimethylhexanedioic acid | 53445-37-7 | CC(CC(=O)O)CC(C)(C)C(=O)O | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.44 |
60 | 2,2,4-trimethylhexanedioic acid; 2,4,4-trimethylhexanedioic acid | 53445-37-7 | CC(CC(=O)O)CC(C)(C)C(=O)O | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.56 |
61 | 2,2,4-trimethylhexanedioic acid; 2,4,4-trimethylhexanedioic acid | 53445-37-7 | CC(CC(=O)O)CC(C)(C)C(=O)O | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.73 |
62 | 2,2,4-trimethylhexane-1,6-diamine | 25513-64-8 | CC(CCN)CC(C)(C)CN | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.07 |
63 | bis(acetyloxy)(ethyl)silyl acetate | 17689-77-9 | CC[Si](OC(C)=O)(OC(C)=O)OC(C)=O | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
64 | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine | 2855-13-2 | CC1(C)CC(N)CC(C)(CN)C1.Cc1ccc(S(=O)(=O)O)cc1 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.08 |
65 | N1,N6-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine | 61260-55-7 | CC1(C)CC(NCCCCCCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.13 |
66 | 4-hydroxy-2,2,6,6-tetramethylpiperidinoxyl | 2226-96-2 | CC1(C)CC(O)CC(C)(C)N1[O] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.09 |
67 | 3,5,5-trimethylcyclohex-2-en-1-one | 78-59-1 | CC1=CC(=O)CC(C)(C)C1 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.95 |
68 | 3,5-dimethylaniline | 108-69-0 | Cc1cc(C)cc(N)c1 | 20.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.25 |
69 | 3,5-dimethylaniline | 108-69-0 | Cc1cc(C)cc(N)c1 | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.95 |
70 | Trisodium bis[3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulphonato(3-)]cobaltate(3-) | 84204-70-6 | Cc1nn(-c2ccccc2)c2c1/N=N/c1cc([N+](=O)[O-])cc(S(=O)(=O)[O-])c1O[Co-]1(Oc3c(cc([N+](=O)[O-])cc3S(=O)(=O)[O-])/N=N/c3c(C)nn(-c4ccccc4)c3O1)O2.[Na+].[Na+].[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.0 |
71 | 5-methylisoxazole-4-carboxylic acid | 42831-50-5 | Cc1oncc1C(=O)[O-] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.9 |
72 | 2-(2-methylbutan-2-yl)phenol | 3279-27-4 | CCC(C)(C)c1ccccc1O | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 2 | 0.98 |
73 | sodium [(2-methylpropoxy)methanethioyl]sulfanide | 25306-75-6 | CCC(C)OC(=S)S.[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.9770000000000001 |
74 | trichloro(propyl)silane | 141-57-1 | CCC[Si](Cl)(Cl)Cl | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.5 |
75 | trichloro(propyl)silane | 141-57-1 | CCC[Si](Cl)(Cl)Cl | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.54 |
76 | trichloro(propyl)silane | 141-57-1 | CCC[Si](Cl)(Cl)Cl | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.54 |
77 | trichloro(propyl)silane | 141-57-1 | CCC[Si](Cl)(Cl)Cl | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.55 |
78 | trichloro(propyl)silane | 141-57-1 | CCC[Si](Cl)(Cl)Cl | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.55 |
79 | trimethoxy(propyl)silane | 1067-25-0 | CCC[Si](OC)(OC)OC | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.5 |
80 | trimethoxy(propyl)silane | 1067-25-0 | CCC[Si](OC)(OC)OC | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.54 |
81 | trimethoxy(propyl)silane | 1067-25-0 | CCC[Si](OC)(OC)OC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.54 |
82 | trimethoxy(propyl)silane | 1067-25-0 | CCC[Si](OC)(OC)OC | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.55 |
83 | trimethoxy(propyl)silane | 1067-25-0 | CCC[Si](OC)(OC)OC | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.55 |
84 | sodium 2-ethylhexyl sulfate | 126-92-1 | CCCCC(CC)COS(=O)(=O)[O-].[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.97 |
85 | hexyltrimethoxysilane | 3069-19-0 | CCCCCC[Si](OC)(OC)OC | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.5 |
86 | hexyltrimethoxysilane | 3069-19-0 | CCCCCC[Si](OC)(OC)OC | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.54 |
87 | hexyltrimethoxysilane | 3069-19-0 | CCCCCC[Si](OC)(OC)OC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.54 |
88 | hexyltrimethoxysilane | 3069-19-0 | CCCCCC[Si](OC)(OC)OC | 14.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.55 |
89 | hexyltrimethoxysilane | 3069-19-0 | CCCCCC[Si](OC)(OC)OC | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.55 |
90 | 4-(tridecan-3-yl)benzene-1-sulfonic acid | 85536-14-7 | CCCCCCCCCCCCc1ccccc1.CS(=O)(=O)O | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.94 |
91 | 3-(chlorodimethylsilyl)propyl 2-methylprop-2-enoate | 24636-31-5 | CCCOC(=O)/C(C)=C/[Si](C)(C)Cl | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
92 | tetrasodium 5-({4-chloro-6-[ethyl(phenyl)amino]-1,3,5-triazin-2-yl}amino)-3-[(E)-2-(1,5-disulfonatonaphthalen-2-yl)diazen-1-yl]-4-hydroxynaphthalene-2,7-disulfonate | 130201-57-9 | CCN(c1ccccc1)c1nc(Cl)nc(Nc2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])c(/N=N/c4ccc5c(S(=O)(=O)[O-])cccc5c4S(=O)(=O)[O-])c(O)c23)n1.[Na+].[Na+].[Na+].[Na+] | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.0 |
93 | triethoxy(methyl)silane | 2031-67-6 | CCO[Si](C)(OCC)OCC | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.74 |
94 | (3-aminopropyl)triethoxysilane | 919-30-2 | CCO[Si](CCCN)(OCC)OCC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.67 |
95 | (2-aminoethyl)[3-(triethoxysilyl)propyl]amine | 5089-72-5 | CCO[Si](CCCNCCN)(OCC)OCC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.39 |
96 | tetraethyl silicate | 78-10-4 | CCO[Si](OCC)(OCC)OCC | 28.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.98 |
97 | ethyl 2-(4-hydroxyphenoxy)propanoate | 71301-98-9 | CCOC(=O)[C@@H](C)Oc1ccc(O)cc1 | 15.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.175 |
98 | ethyl 2-(4-hydroxyphenoxy)propanoate | 71301-98-9 | CCOC(=O)[C@@H](C)Oc1ccc(O)cc1 | 7.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.251 |
99 | ethyl 2-(4-hydroxyphenoxy)propanoate | 71301-98-9 | CCOC(=O)[C@@H](C)Oc1ccc(O)cc1 | 21.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.698 |
100 | ethyl 2-(4-hydroxyphenoxy)propanoate | 71301-98-9 | CCOC(=O)[C@@H](C)Oc1ccc(O)cc1 | 27.0 | EU Method C.4-A | DOC Die Away | Ready | 1 | 0.938 |
Note:
Above table only shows the first 100 entries of the dataset used to build this model.
To access the complete dataset, please click on the "Download the complete dataset" on the top right corner to download the original file.